About 2-formyliminopropanamide
2-formyliminopropanamide (PubChem CID 141006199) has the molecular formula C4H6N2O2
and a molecular weight of 114.10 g/mol. Its IUPAC name is 2-formyliminopropanamide.
Molecular Properties
| Compound Name | 2-formyliminopropanamide |
| PubChem CID | 141006199 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | 2-formyliminopropanamide |
| SMILES | C/C(=N\C=O)C(N)=O |
| InChI | InChI=1S/C4H6N2O2/c1-3(4(5)8)6-2-7/h2H,1H3,(H2,5,8)/b6-3+ |
| InChIKey | SROISDXUTRJCQI-ZZXKWVIFSA-N |
| XLogP | -0.91 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-formyliminopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-formyliminopropanamide?
The IUPAC name of 2-formyliminopropanamide (CID 141006199) is 2-formyliminopropanamide.
What is the SMILES notation for 2-formyliminopropanamide?
The canonical SMILES for 2-formyliminopropanamide is C/C(=N\C=O)C(N)=O.
What is the InChIKey of 2-formyliminopropanamide?
The InChIKey is SROISDXUTRJCQI-ZZXKWVIFSA-N. The full InChI is InChI=1S/C4H6N2O2/c1-3(4(5)8)6-2-7/h2H,1H3,(H2,5,8)/b6-3+.
What are the key properties of 2-formyliminopropanamide?
2-formyliminopropanamide has a molecular weight of 114.10 g/mol, XLogP of -0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formyliminopropanamide is sourced from PubChem (CID 141006199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).