C17H15ClN2O5 — CID 141008075
4-chloro-3-[[2-methyl-3-(2-nitrophenyl)propanoyl]amino]benzoic acid (PubChem CID 141008075) has the molecular formula C17H15ClN2O5 and a molecular weight of 362.77 g/mol. Its IUPAC name is 4-chloro-3-[[2-methyl-3-(2-nitrophenyl)propanoyl]amino]benzoic acid.
| Compound Name | 4-chloro-3-[[2-methyl-3-(2-nitrophenyl)propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 141008075 |
| Molecular Formula | C17H15ClN2O5 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 4-chloro-3-[[2-methyl-3-(2-nitrophenyl)propanoyl]amino]benzoic acid |
| SMILES | CC(Cc1ccccc1[N+](=O)[O-])C(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C17H15ClN2O5/c1-10(8-11-4-2-3-5-15(11)20(24)25)16(21)19-14-9-12(17(22)23)6-7-13(14)18/h2-7,9-10H,8H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | BVHFELHGJARWMW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|