C8H13NO2S2 — CID 141008123
2-ethylsulfanylethyl 2H-1,3-thiazole-3-carboxylate (PubChem CID 141008123) has the molecular formula C8H13NO2S2 and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-ethylsulfanylethyl 2H-1,3-thiazole-3-carboxylate.
| Compound Name | 2-ethylsulfanylethyl 2H-1,3-thiazole-3-carboxylate |
|---|---|
| PubChem CID | 141008123 |
| Molecular Formula | C8H13NO2S2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 2-ethylsulfanylethyl 2H-1,3-thiazole-3-carboxylate |
| SMILES | CCSCCOC(=O)N1C=CSC1 |
| InChI | InChI=1S/C8H13NO2S2/c1-2-12-6-4-11-8(10)9-3-5-13-7-9/h3,5H,2,4,6-7H2,1H3 |
| InChIKey | MIVXOXUHOSRTSR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|