C21H24O3 — CID 141009009
ethyl 2-(14-methoxy-13-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,9,14-hexaenyl)acetate (PubChem CID 141009009) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is ethyl 2-(14-methoxy-13-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,9,14-hexaenyl)acetate.
| Compound Name | ethyl 2-(14-methoxy-13-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,9,14-hexaenyl)acetate |
|---|---|
| PubChem CID | 141009009 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | ethyl 2-(14-methoxy-13-methyl-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,9,14-hexaenyl)acetate |
| SMILES | CCOC(=O)CC1=CC2=C(C=C(OC)C(C)C2)Cc2ccccc21 |
| InChI | InChI=1S/C21H24O3/c1-4-24-21(22)13-18-11-16-9-14(2)20(23-3)12-17(16)10-15-7-5-6-8-19(15)18/h5-8,11-12,14H,4,9-10,13H2,1-3H3 |
| InChIKey | SENCOCXQGHJHDF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |