C16H13BrO3 — CID 141009493
3-(2-bromo-5-methoxyphenyl)-1-phenylpropane-1,2-dione (PubChem CID 141009493) has the molecular formula C16H13BrO3 and a molecular weight of 333.18 g/mol. Its IUPAC name is 3-(2-bromo-5-methoxyphenyl)-1-phenylpropane-1,2-dione.
| Compound Name | 3-(2-bromo-5-methoxyphenyl)-1-phenylpropane-1,2-dione |
|---|---|
| PubChem CID | 141009493 |
| Molecular Formula | C16H13BrO3 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | 3-(2-bromo-5-methoxyphenyl)-1-phenylpropane-1,2-dione |
| SMILES | COc1ccc(Br)c(CC(=O)C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H13BrO3/c1-20-13-7-8-14(17)12(9-13)10-15(18)16(19)11-5-3-2-4-6-11/h2-9H,10H2,1H3 |
| InChIKey | GUVRYSMBCNRTPM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|