C22H34O3S — CID 141011691
1,2,6-tributyl-2H-naphthalene-1-sulfonic acid (PubChem CID 141011691) has the molecular formula C22H34O3S and a molecular weight of 378.58 g/mol. Its IUPAC name is 1,2,6-tributyl-2H-naphthalene-1-sulfonic acid.
| Compound Name | 1,2,6-tributyl-2H-naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 141011691 |
| Molecular Formula | C22H34O3S |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1,2,6-tributyl-2H-naphthalene-1-sulfonic acid |
| SMILES | CCCCc1ccc2c(c1)C=CC(CCCC)C2(CCCC)S(=O)(=O)O |
| InChI | InChI=1S/C22H34O3S/c1-4-7-10-18-12-15-21-19(17-18)13-14-20(11-8-5-2)22(21,16-9-6-3)26(23,24)25/h12-15,17,20H,4-11,16H2,1-3H3,(H,23,24,25) |
| InChIKey | UULQLRNXPUTAFG-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|