C21H20F2O — CID 139850097
1,1-difluoro-6-(4-pentylphenyl)naphthalen-2-one (PubChem CID 139850097) has the molecular formula C21H20F2O and a molecular weight of 326.39 g/mol. Its IUPAC name is 1,1-difluoro-6-(4-pentylphenyl)naphthalen-2-one.
| Compound Name | 1,1-difluoro-6-(4-pentylphenyl)naphthalen-2-one |
|---|---|
| PubChem CID | 139850097 |
| Molecular Formula | C21H20F2O |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1,1-difluoro-6-(4-pentylphenyl)naphthalen-2-one |
| SMILES | CCCCCc1ccc(-c2ccc3c(c2)C=CC(=O)C3(F)F)cc1 |
| InChI | InChI=1S/C21H20F2O/c1-2-3-4-5-15-6-8-16(9-7-15)17-10-12-19-18(14-17)11-13-20(24)21(19,22)23/h6-14H,2-5H2,1H3 |
| InChIKey | XMQUPCLVVLHFFF-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|