C28H24F4O — CID 139849942
7b-fluoro-5-(4-hexylphenyl)-1a-(3,4,5-trifluorophenyl)naphtho[1,2-b]oxirene (PubChem CID 139849942) has the molecular formula C28H24F4O and a molecular weight of 452.49 g/mol. Its IUPAC name is 7b-fluoro-5-(4-hexylphenyl)-1a-(3,4,5-trifluorophenyl)naphtho[1,2-b]oxirene.
| Compound Name | 7b-fluoro-5-(4-hexylphenyl)-1a-(3,4,5-trifluorophenyl)naphtho[1,2-b]oxirene |
|---|---|
| PubChem CID | 139849942 |
| Molecular Formula | C28H24F4O |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 7b-fluoro-5-(4-hexylphenyl)-1a-(3,4,5-trifluorophenyl)naphtho[1,2-b]oxirene |
| SMILES | CCCCCCc1ccc(-c2ccc3c(c2)C=CC2(c4cc(F)c(F)c(F)c4)OC32F)cc1 |
| InChI | InChI=1S/C28H24F4O/c1-2-3-4-5-6-18-7-9-19(10-8-18)20-11-12-23-21(15-20)13-14-27(28(23,32)33-27)22-16-24(29)26(31)25(30)17-22/h7-17H,2-6H2,1H3 |
| InChIKey | TXUDIHXJDXMIQZ-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|