C19H18F2O — CID 139850207
1,1-difluoro-6-(4-propylphenyl)-2H-naphthalen-2-ol (PubChem CID 139850207) has the molecular formula C19H18F2O and a molecular weight of 300.35 g/mol. Its IUPAC name is 1,1-difluoro-6-(4-propylphenyl)-2H-naphthalen-2-ol.
| Compound Name | 1,1-difluoro-6-(4-propylphenyl)-2H-naphthalen-2-ol |
|---|---|
| PubChem CID | 139850207 |
| Molecular Formula | C19H18F2O |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1,1-difluoro-6-(4-propylphenyl)-2H-naphthalen-2-ol |
| SMILES | CCCc1ccc(-c2ccc3c(c2)C=CC(O)C3(F)F)cc1 |
| InChI | InChI=1S/C19H18F2O/c1-2-3-13-4-6-14(7-5-13)15-8-10-17-16(12-15)9-11-18(22)19(17,20)21/h4-12,18,22H,2-3H2,1H3 |
| InChIKey | VFFMPZGEMYHMEJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |