C10H8N2O2S — CID 141012996
1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide (PubChem CID 141012996) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is 1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide.
| Compound Name | 1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide |
|---|---|
| PubChem CID | 141012996 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 1H-pyrrolo[2,1-c][1,2,4]benzothiadiazine 5,5-dioxide |
| SMILES | O=S1(=O)N=C2C=CCN2c2ccccc21 |
| InChI | InChI=1S/C10H8N2O2S/c13-15(14)9-5-2-1-4-8(9)12-7-3-6-10(12)11-15/h1-6H,7H2 |
| InChIKey | KBPDZNPJIMECOS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |