About 4-fluoroundec-3-ene
4-fluoroundec-3-ene (PubChem CID 141013194) has the molecular formula C11H21F
and a molecular weight of 172.29 g/mol. Its IUPAC name is 4-fluoroundec-3-ene.
Molecular Properties
| Compound Name | 4-fluoroundec-3-ene |
| PubChem CID | 141013194 |
| Molecular Formula | C11H21F |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.16 |
| IUPAC Name | 4-fluoroundec-3-ene |
| SMILES | CCC=C(F)CCCCCCC |
| InChI | InChI=1S/C11H21F/c1-3-5-6-7-8-10-11(12)9-4-2/h9H,3-8,10H2,1-2H3 |
| InChIKey | WYKVNMQCSQJQJN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoroundec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoroundec-3-ene?
The IUPAC name of 4-fluoroundec-3-ene (CID 141013194) is 4-fluoroundec-3-ene.
What is the SMILES notation for 4-fluoroundec-3-ene?
The canonical SMILES for 4-fluoroundec-3-ene is CCC=C(F)CCCCCCC.
What is the InChIKey of 4-fluoroundec-3-ene?
The InChIKey is WYKVNMQCSQJQJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F/c1-3-5-6-7-8-10-11(12)9-4-2/h9H,3-8,10H2,1-2H3.
What are the key properties of 4-fluoroundec-3-ene?
4-fluoroundec-3-ene has a molecular weight of 172.29 g/mol, XLogP of 4.61, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoroundec-3-ene is sourced from PubChem (CID 141013194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).