About 7-ethyl-5,7,14-triazatetracyclo[10.3.1.02,10.04,8]hexadecane
7-ethyl-5,7,14-triazatetracyclo[10.3.1.02,10.04,8]hexadecane (PubChem CID 141013742) has the molecular formula C15H27N3
and a molecular weight of 249.40 g/mol. Its IUPAC name is 7-ethyl-5,7,14-triazatetracyclo[10.3.1.02,10.04,8]hexadecane.
Analyze 7-ethyl-5,7,14-triazatetracyclo[10.3.1.02,10.04,8]hexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-5,7,14-triazatetracyclo[10.3.1.02,10.04,8]hexadecane?
The IUPAC name of 7-ethyl-5,7,14-triazatetracyclo[10.3.1.02,10.04,8]hexadecane (CID 141013742) is 7-ethyl-5,7,14-triazatetracyclo[10.3.1.02,10.04,8]hexadecane.
What is the SMILES notation for 7-ethyl-5,7,14-triazatetracyclo[10.3.1.02,10.04,8]hexadecane?
The canonical SMILES for 7-ethyl-5,7,14-triazatetracyclo[10.3.1.02,10.04,8]hexadecane is CCN1CNC2CC3C4CNCC(C4)CC3CC21.
What is the InChIKey of 7-ethyl-5,7,14-triazatetracyclo[10.3.1.02,10.04,8]hexadecane?
The InChIKey is MZLWPXYYKBPAKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3/c1-2-18-9-17-14-6-13-11(5-15(14)18)3-10-4-12(13)8-16-7-10/h10-17H,2-9H2,1H3.
What are the key properties of 7-ethyl-5,7,14-triazatetracyclo[10.3.1.02,10.04,8]hexadecane?
7-ethyl-5,7,14-triazatetracyclo[10.3.1.02,10.04,8]hexadecane has a molecular weight of 249.40 g/mol, XLogP of 1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-5,7,14-triazatetracyclo[10.3.1.02,10.04,8]hexadecane is sourced from PubChem (CID 141013742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).