C9H5FN2O4 — CID 141014120
2-[(2,3-dioxoaziridin-1-yl)amino]-4-fluorobenzoic acid (PubChem CID 141014120) has the molecular formula C9H5FN2O4 and a molecular weight of 224.15 g/mol. Its IUPAC name is 2-[(2,3-dioxoaziridin-1-yl)amino]-4-fluorobenzoic acid.
| Compound Name | 2-[(2,3-dioxoaziridin-1-yl)amino]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 141014120 |
| Molecular Formula | C9H5FN2O4 |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 2-[(2,3-dioxoaziridin-1-yl)amino]-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)cc1Nn1c(=O)c1=O |
| InChI | InChI=1S/C9H5FN2O4/c10-4-1-2-5(9(15)16)6(3-4)11-12-7(13)8(12)14/h1-3,11H,(H,15,16) |
| InChIKey | XGZNIHGDHTYZAY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|