C8H12N4O3 — CID 141014991
2-[2-(2,4-dioxo-1H-pyrimidin-3-yl)ethylamino]acetamide (PubChem CID 141014991) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-[2-(2,4-dioxo-1H-pyrimidin-3-yl)ethylamino]acetamide.
| Compound Name | 2-[2-(2,4-dioxo-1H-pyrimidin-3-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 141014991 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-[2-(2,4-dioxo-1H-pyrimidin-3-yl)ethylamino]acetamide |
| SMILES | NC(=O)CNCCn1c(=O)cc[nH]c1=O |
| InChI | InChI=1S/C8H12N4O3/c9-6(13)5-10-3-4-12-7(14)1-2-11-8(12)15/h1-2,10H,3-5H2,(H2,9,13)(H,11,15) |
| InChIKey | MQSXTHLXYRVDSQ-UHFFFAOYSA-N |
| XLogP | -2.39 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|