About 1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide
1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide (PubChem CID 2227167) has the molecular formula C10H15N3O3
and a molecular weight of 225.25 g/mol. Its IUPAC name is 1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide |
| PubChem CID | 2227167 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide |
| SMILES | CC(C)NC(=O)c1cc(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C10H15N3O3/c1-6(2)11-9(15)7-5-8(14)13(4)10(16)12(7)3/h5-6H,1-4H3,(H,11,15) |
| InChIKey | JXRZMXOIMFURIJ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide?
The IUPAC name of 1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide (CID 2227167) is 1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide.
What is the SMILES notation for 1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide?
The canonical SMILES for 1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide is CC(C)NC(=O)c1cc(=O)n(C)c(=O)n1C.
What is the InChIKey of 1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide?
The InChIKey is JXRZMXOIMFURIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O3/c1-6(2)11-9(15)7-5-8(14)13(4)10(16)12(7)3/h5-6H,1-4H3,(H,11,15).
What are the key properties of 1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide?
1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide has a molecular weight of 225.25 g/mol, XLogP of -0.78, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-2,6-dioxo-N-propan-2-ylpyrimidine-4-carboxamide is sourced from PubChem (CID 2227167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).