C11H17N3O3 — CID 21204487
N-hexyl-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 21204487) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-hexyl-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-hexyl-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 21204487 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-hexyl-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | CCCCCCNC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C11H17N3O3/c1-2-3-4-5-6-12-10(16)8-7-9(15)14-11(17)13-8/h7H,2-6H2,1H3,(H,12,16)(H2,13,14,15,17) |
| InChIKey | JVRQQYDFKWIOKD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|