About 4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline
4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline (PubChem CID 141015297) has the molecular formula C23H21Cl2N3O
and a molecular weight of 426.35 g/mol. Its IUPAC name is 4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline.
Molecular Properties
| Compound Name | 4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline |
| PubChem CID | 141015297 |
| Molecular Formula | C23H21Cl2N3O |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline |
| SMILES | COc1ccc2c(c1)NN(CCc1ccccc1)C=C2Cc1c(Cl)cncc1Cl |
| InChI | InChI=1S/C23H21Cl2N3O/c1-29-18-7-8-19-17(11-20-21(24)13-26-14-22(20)25)15-28(27-23(19)12-18)10-9-16-5-3-2-4-6-16/h2-8,12-15,27H,9-11H2,1H3 |
| InChIKey | YATGPKNKWAJYRK-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline?
The IUPAC name of 4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline (CID 141015297) is 4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline.
What is the SMILES notation for 4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline?
The canonical SMILES for 4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline is COc1ccc2c(c1)NN(CCc1ccccc1)C=C2Cc1c(Cl)cncc1Cl.
What is the InChIKey of 4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline?
The InChIKey is YATGPKNKWAJYRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21Cl2N3O/c1-29-18-7-8-19-17(11-20-21(24)13-26-14-22(20)25)15-28(27-23(19)12-18)10-9-16-5-3-2-4-6-16/h2-8,12-15,27H,9-11H2,1H3.
What are the key properties of 4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline?
4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline has a molecular weight of 426.35 g/mol, XLogP of 5.87, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dichloro-4-pyridinyl)methyl]-7-methoxy-2-(2-phenylethyl)-1H-cinnoline is sourced from PubChem (CID 141015297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).