C20H23Cl2N3 — CID 141015697
N'-[1-(3,4-dichlorophenyl)ethyl]-N-(1,2-dihydroquinolin-2-yl)propane-1,3-diamine (PubChem CID 141015697) has the molecular formula C20H23Cl2N3 and a molecular weight of 376.33 g/mol. Its IUPAC name is N'-[1-(3,4-dichlorophenyl)ethyl]-N-(1,2-dihydroquinolin-2-yl)propane-1,3-diamine.
| Compound Name | N'-[1-(3,4-dichlorophenyl)ethyl]-N-(1,2-dihydroquinolin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 141015697 |
| Molecular Formula | C20H23Cl2N3 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N'-[1-(3,4-dichlorophenyl)ethyl]-N-(1,2-dihydroquinolin-2-yl)propane-1,3-diamine |
| SMILES | CC(NCCCNC1C=Cc2ccccc2N1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H23Cl2N3/c1-14(16-7-9-17(21)18(22)13-16)23-11-4-12-24-20-10-8-15-5-2-3-6-19(15)25-20/h2-3,5-10,13-14,20,23-25H,4,11-12H2,1H3 |
| InChIKey | XYJCWMVMDSZCPE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|