C25H30N2O3 — CID 141017547
cyclopentyl N-[3-[(2-methoxyphenyl)methyl]-1-propylindol-5-yl]carbamate (PubChem CID 141017547) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is cyclopentyl N-[3-[(2-methoxyphenyl)methyl]-1-propylindol-5-yl]carbamate.
| Compound Name | cyclopentyl N-[3-[(2-methoxyphenyl)methyl]-1-propylindol-5-yl]carbamate |
|---|---|
| PubChem CID | 141017547 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | cyclopentyl N-[3-[(2-methoxyphenyl)methyl]-1-propylindol-5-yl]carbamate |
| SMILES | CCCn1cc(Cc2ccccc2OC)c2cc(NC(=O)OC3CCCC3)ccc21 |
| InChI | InChI=1S/C25H30N2O3/c1-3-14-27-17-19(15-18-8-4-7-11-24(18)29-2)22-16-20(12-13-23(22)27)26-25(28)30-21-9-5-6-10-21/h4,7-8,11-13,16-17,21H,3,5-6,9-10,14-15H2,1-2H3,(H,26,28) |
| InChIKey | PQPVPYOGBQKGRC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |