C37H35N3O6 — CID 86743327
diphenylcarbamoyl 4-[[5-(cyclopentyloxycarbonylamino)-1-methylindol-3-yl]methyl]-3-methoxybenzoate (PubChem CID 86743327) has the molecular formula C37H35N3O6 and a molecular weight of 617.70 g/mol. Its IUPAC name is diphenylcarbamoyl 4-[[5-(cyclopentyloxycarbonylamino)-1-methylindol-3-yl]methyl]-3-methoxybenzoate.
| Compound Name | diphenylcarbamoyl 4-[[5-(cyclopentyloxycarbonylamino)-1-methylindol-3-yl]methyl]-3-methoxybenzoate |
|---|---|
| PubChem CID | 86743327 |
| Molecular Formula | C37H35N3O6 |
| Molecular Weight | 617.70 g/mol |
| Exact Mass | 617.25 |
| IUPAC Name | diphenylcarbamoyl 4-[[5-(cyclopentyloxycarbonylamino)-1-methylindol-3-yl]methyl]-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OC(=O)N(c2ccccc2)c2ccccc2)ccc1Cc1cn(C)c2ccc(NC(=O)OC3CCCC3)cc12 |
| InChI | InChI=1S/C37H35N3O6/c1-39-24-27(32-23-28(19-20-33(32)39)38-36(42)45-31-15-9-10-16-31)21-25-17-18-26(22-34(25)44-2)35(41)46-37(43)40(29-11-5-3-6-12-29)30-13-7-4-8-14-30/h3-8,11-14,17-20,22-24,31H,9-10,15-16,21H2,1-2H3,(H,38,42) |
| InChIKey | VFYQECNTORGNQA-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.70 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|