C20H27NO7 — CID 141018843
2-[1-[2-(3,4-dimethoxyphenyl)ethyl]-5-ethyl-2-oxopiperidin-4-yl]propanedioic acid (PubChem CID 141018843) has the molecular formula C20H27NO7 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[1-[2-(3,4-dimethoxyphenyl)ethyl]-5-ethyl-2-oxopiperidin-4-yl]propanedioic acid.
| Compound Name | 2-[1-[2-(3,4-dimethoxyphenyl)ethyl]-5-ethyl-2-oxopiperidin-4-yl]propanedioic acid |
|---|---|
| PubChem CID | 141018843 |
| Molecular Formula | C20H27NO7 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-[1-[2-(3,4-dimethoxyphenyl)ethyl]-5-ethyl-2-oxopiperidin-4-yl]propanedioic acid |
| SMILES | CCC1CN(CCc2ccc(OC)c(OC)c2)C(=O)CC1C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H27NO7/c1-4-13-11-21(17(22)10-14(13)18(19(23)24)20(25)26)8-7-12-5-6-15(27-2)16(9-12)28-3/h5-6,9,13-14,18H,4,7-8,10-11H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | PEARTZIJOZCBJQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|