C17H23NO5 — CID 168693183
methyl 1-[2-(4-ethoxy-3-methoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 168693183) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is methyl 1-[2-(4-ethoxy-3-methoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-[2-(4-ethoxy-3-methoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168693183 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | methyl 1-[2-(4-ethoxy-3-methoxyphenyl)ethyl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOc1ccc(CCN2CC(C(=O)OC)CC2=O)cc1OC |
| InChI | InChI=1S/C17H23NO5/c1-4-23-14-6-5-12(9-15(14)21-2)7-8-18-11-13(10-16(18)19)17(20)22-3/h5-6,9,13H,4,7-8,10-11H2,1-3H3 |
| InChIKey | FCSXSELOYUOLKM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |