C16H22FNO5S — CID 168675384
[1-[2-(4-ethoxy-3-methoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168675384) has the molecular formula C16H22FNO5S and a molecular weight of 359.42 g/mol. Its IUPAC name is [1-[2-(4-ethoxy-3-methoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-[2-(4-ethoxy-3-methoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168675384 |
| Molecular Formula | C16H22FNO5S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | [1-[2-(4-ethoxy-3-methoxyphenyl)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | CCOc1ccc(CCN2CC(CS(=O)(=O)F)CC2=O)cc1OC |
| InChI | InChI=1S/C16H22FNO5S/c1-3-23-14-5-4-12(8-15(14)22-2)6-7-18-10-13(9-16(18)19)11-24(17,20)21/h4-5,8,13H,3,6-7,9-11H2,1-2H3 |
| InChIKey | RWQUUSDNSUXZNU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |