C14H12ClFN2O4 — CID 141019273
methyl 2-[[3-[3-(chloroamino)-4-fluorophenoxy]-2-pyridinyl]oxy]acetate (PubChem CID 141019273) has the molecular formula C14H12ClFN2O4 and a molecular weight of 326.71 g/mol. Its IUPAC name is methyl 2-[[3-[3-(chloroamino)-4-fluorophenoxy]-2-pyridinyl]oxy]acetate.
| Compound Name | methyl 2-[[3-[3-(chloroamino)-4-fluorophenoxy]-2-pyridinyl]oxy]acetate |
|---|---|
| PubChem CID | 141019273 |
| Molecular Formula | C14H12ClFN2O4 |
| Molecular Weight | 326.71 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | methyl 2-[[3-[3-(chloroamino)-4-fluorophenoxy]-2-pyridinyl]oxy]acetate |
| SMILES | COC(=O)COc1ncccc1Oc1ccc(F)c(NCl)c1 |
| InChI | InChI=1S/C14H12ClFN2O4/c1-20-13(19)8-21-14-12(3-2-6-17-14)22-9-4-5-10(16)11(7-9)18-15/h2-7,18H,8H2,1H3 |
| InChIKey | QOLVGVKSMPJSFC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.71 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|