C22H33N3 — CID 141019607
2-[1-(1-propan-2-ylcycloheptyl)piperidin-4-yl]-1H-benzimidazole (PubChem CID 141019607) has the molecular formula C22H33N3 and a molecular weight of 339.53 g/mol. Its IUPAC name is 2-[1-(1-propan-2-ylcycloheptyl)piperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-[1-(1-propan-2-ylcycloheptyl)piperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 141019607 |
| Molecular Formula | C22H33N3 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.27 |
| IUPAC Name | 2-[1-(1-propan-2-ylcycloheptyl)piperidin-4-yl]-1H-benzimidazole |
| SMILES | CC(C)C1(N2CCC(c3nc4ccccc4[nH]3)CC2)CCCCCC1 |
| InChI | InChI=1S/C22H33N3/c1-17(2)22(13-7-3-4-8-14-22)25-15-11-18(12-16-25)21-23-19-9-5-6-10-20(19)24-21/h5-6,9-10,17-18H,3-4,7-8,11-16H2,1-2H3,(H,23,24) |
| InChIKey | KHINYAXHBRTPCJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |