C20H17N5O2 — CID 141021252
7-[(4-methoxyphenyl)methylamino]-1-phenylpyrimido[4,5-d]pyrimidin-2-one (PubChem CID 141021252) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 7-[(4-methoxyphenyl)methylamino]-1-phenylpyrimido[4,5-d]pyrimidin-2-one.
| Compound Name | 7-[(4-methoxyphenyl)methylamino]-1-phenylpyrimido[4,5-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 141021252 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 7-[(4-methoxyphenyl)methylamino]-1-phenylpyrimido[4,5-d]pyrimidin-2-one |
| SMILES | COc1ccc(CNc2ncc3cnc(=O)n(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C20H17N5O2/c1-27-17-9-7-14(8-10-17)11-21-19-22-12-15-13-23-20(26)25(18(15)24-19)16-5-3-2-4-6-16/h2-10,12-13H,11H2,1H3,(H,21,22,24) |
| InChIKey | GFOHEWKUGJITCF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |