C21H18N4O2 — CID 69378637
2-[(4-methoxyphenyl)methylamino]-8-phenylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 69378637) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylamino]-8-phenylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[(4-methoxyphenyl)methylamino]-8-phenylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 69378637 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylamino]-8-phenylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | COc1ccc(CNc2ncc3ccc(=O)n(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C21H18N4O2/c1-27-18-10-7-15(8-11-18)13-22-21-23-14-16-9-12-19(26)25(20(16)24-21)17-5-3-2-4-6-17/h2-12,14H,13H2,1H3,(H,22,23,24) |
| InChIKey | WAMBMXDAXWDGOC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |