C21H25N5O — CID 69378325
8-phenyl-2-(3-piperidin-1-ylpropylamino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 69378325) has the molecular formula C21H25N5O and a molecular weight of 363.46 g/mol. Its IUPAC name is 8-phenyl-2-(3-piperidin-1-ylpropylamino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-phenyl-2-(3-piperidin-1-ylpropylamino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 69378325 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 8-phenyl-2-(3-piperidin-1-ylpropylamino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(NCCCN3CCCCC3)nc2n1-c1ccccc1 |
| InChI | InChI=1S/C21H25N5O/c27-19-11-10-17-16-23-21(22-12-7-15-25-13-5-2-6-14-25)24-20(17)26(19)18-8-3-1-4-9-18/h1,3-4,8-11,16H,2,5-7,12-15H2,(H,22,23,24) |
| InChIKey | JBOVJSPHACJONE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|