C13H17N5O — CID 121470891
2-(2-pyrrolidin-1-ylethylamino)-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 121470891) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-(2-pyrrolidin-1-ylethylamino)-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(2-pyrrolidin-1-ylethylamino)-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 121470891 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 2-(2-pyrrolidin-1-ylethylamino)-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(NCCN3CCCC3)nc2[nH]1 |
| InChI | InChI=1S/C13H17N5O/c19-11-4-3-10-9-15-13(17-12(10)16-11)14-5-8-18-6-1-2-7-18/h3-4,9H,1-2,5-8H2,(H2,14,15,16,17,19) |
| InChIKey | HKAFCUGOQQYFCU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |