C9H10N4O2 — CID 121470912
2-(2-hydroxyethylamino)-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 121470912) has the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-(2-hydroxyethylamino)-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 121470912 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-(2-hydroxyethylamino)-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(NCCO)nc2[nH]1 |
| InChI | InChI=1S/C9H10N4O2/c14-4-3-10-9-11-5-6-1-2-7(15)12-8(6)13-9/h1-2,5,14H,3-4H2,(H2,10,11,12,13,15) |
| InChIKey | UDQKFJHINRUZPH-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |