C14H19N3O — CID 175827210
2-heptyl-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 175827210) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-heptyl-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-heptyl-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 175827210 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-heptyl-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCCCCCc1ncc2ccc(=O)[nH]c2n1 |
| InChI | InChI=1S/C14H19N3O/c1-2-3-4-5-6-7-12-15-10-11-8-9-13(18)17-14(11)16-12/h8-10H,2-7H2,1H3,(H,15,16,17,18) |
| InChIKey | NTABQDTXWHKZKP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|