C15H17N3 — CID 68572299
2-pentyl-7H-pyrrolo[2,3-h]quinazoline (PubChem CID 68572299) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-pentyl-7H-pyrrolo[2,3-h]quinazoline.
| Compound Name | 2-pentyl-7H-pyrrolo[2,3-h]quinazoline |
|---|---|
| PubChem CID | 68572299 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-pentyl-7H-pyrrolo[2,3-h]quinazoline |
| SMILES | CCCCCc1ncc2ccc3[nH]ccc3c2n1 |
| InChI | InChI=1S/C15H17N3/c1-2-3-4-5-14-17-10-11-6-7-13-12(8-9-16-13)15(11)18-14/h6-10,16H,2-5H2,1H3 |
| InChIKey | GJJMGPBPOLKTAN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|