C12H16N4 — CID 67700184
2-pentylpyrido[2,3-d]pyrimidin-7-amine (PubChem CID 67700184) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 2-pentylpyrido[2,3-d]pyrimidin-7-amine.
| Compound Name | 2-pentylpyrido[2,3-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 67700184 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-pentylpyrido[2,3-d]pyrimidin-7-amine |
| SMILES | CCCCCc1ncc2ccc(N)nc2n1 |
| InChI | InChI=1S/C12H16N4/c1-2-3-4-5-11-14-8-9-6-7-10(13)15-12(9)16-11/h6-8H,2-5H2,1H3,(H2,13,14,15,16) |
| InChIKey | PRZDBMBDJDZIGH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|