C13H16FN5OS — CID 142289469
2-[[1-(fluoromethylsulfanyl)piperidin-4-yl]amino]-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 142289469) has the molecular formula C13H16FN5OS and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-[[1-(fluoromethylsulfanyl)piperidin-4-yl]amino]-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[[1-(fluoromethylsulfanyl)piperidin-4-yl]amino]-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 142289469 |
| Molecular Formula | C13H16FN5OS |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[[1-(fluoromethylsulfanyl)piperidin-4-yl]amino]-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cnc(NC3CCN(SCF)CC3)nc2[nH]1 |
| InChI | InChI=1S/C13H16FN5OS/c14-8-21-19-5-3-10(4-6-19)16-13-15-7-9-1-2-11(20)17-12(9)18-13/h1-2,7,10H,3-6,8H2,(H2,15,16,17,18,20) |
| InChIKey | YEJBYIFGEWCUEE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|