C21H32F3N5O2S — CID 142289462
cyclopentanol;ethane;6-methyl-2-[[1-(trifluoromethylsulfanyl)piperidin-4-yl]amino]-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 142289462) has the molecular formula C21H32F3N5O2S and a molecular weight of 475.58 g/mol. Its IUPAC name is cyclopentanol;ethane;6-methyl-2-[[1-(trifluoromethylsulfanyl)piperidin-4-yl]amino]-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | cyclopentanol;ethane;6-methyl-2-[[1-(trifluoromethylsulfanyl)piperidin-4-yl]amino]-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 142289462 |
| Molecular Formula | C21H32F3N5O2S |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | cyclopentanol;ethane;6-methyl-2-[[1-(trifluoromethylsulfanyl)piperidin-4-yl]amino]-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC.Cc1cc2cnc(NC3CCN(SC(F)(F)F)CC3)nc2[nH]c1=O.OC1CCCC1 |
| InChI | InChI=1S/C14H16F3N5OS.C5H10O.C2H6/c1-8-6-9-7-18-13(21-11(9)20-12(8)23)19-10-2-4-22(5-3-10)24-14(15,16)17;6-5-3-1-2-4-5;1-2/h6-7,10H,2-5H2,1H3,(H2,18,19,20,21,23);5-6H,1-4H2;1-2H3 |
| InChIKey | MUGBECQANQQSEW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|