C20H21ClN6O3 — CID 87987131
N-aminooxy-4-[[6-(2-chlorophenyl)-7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexane-1-carboxamide (PubChem CID 87987131) has the molecular formula C20H21ClN6O3 and a molecular weight of 428.88 g/mol. Its IUPAC name is N-aminooxy-4-[[6-(2-chlorophenyl)-7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexane-1-carboxamide.
| Compound Name | N-aminooxy-4-[[6-(2-chlorophenyl)-7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87987131 |
| Molecular Formula | C20H21ClN6O3 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-aminooxy-4-[[6-(2-chlorophenyl)-7-oxo-8H-pyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexane-1-carboxamide |
| SMILES | NONC(=O)C1CCC(Nc2ncc3cc(-c4ccccc4Cl)c(=O)[nH]c3n2)CC1 |
| InChI | InChI=1S/C20H21ClN6O3/c21-16-4-2-1-3-14(16)15-9-12-10-23-20(26-17(12)25-19(15)29)24-13-7-5-11(6-8-13)18(28)27-30-22/h1-4,9-11,13H,5-8,22H2,(H,27,28)(H2,23,24,25,26,29) |
| InChIKey | JQKVVVACDDYYOB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|