C21H30N6O2S — CID 142289485
2-[8-cyclohexyl-2-[(1-methylsulfanylpiperidin-4-yl)amino]-7-oxopyrido[2,3-d]pyrimidin-6-yl]acetamide (PubChem CID 142289485) has the molecular formula C21H30N6O2S and a molecular weight of 430.58 g/mol. Its IUPAC name is 2-[8-cyclohexyl-2-[(1-methylsulfanylpiperidin-4-yl)amino]-7-oxopyrido[2,3-d]pyrimidin-6-yl]acetamide.
| Compound Name | 2-[8-cyclohexyl-2-[(1-methylsulfanylpiperidin-4-yl)amino]-7-oxopyrido[2,3-d]pyrimidin-6-yl]acetamide |
|---|---|
| PubChem CID | 142289485 |
| Molecular Formula | C21H30N6O2S |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 2-[8-cyclohexyl-2-[(1-methylsulfanylpiperidin-4-yl)amino]-7-oxopyrido[2,3-d]pyrimidin-6-yl]acetamide |
| SMILES | CSN1CCC(Nc2ncc3cc(CC(N)=O)c(=O)n(C4CCCCC4)c3n2)CC1 |
| InChI | InChI=1S/C21H30N6O2S/c1-30-26-9-7-16(8-10-26)24-21-23-13-15-11-14(12-18(22)28)20(29)27(19(15)25-21)17-5-3-2-4-6-17/h11,13,16-17H,2-10,12H2,1H3,(H2,22,28)(H,23,24,25) |
| InChIKey | QPNZKAYAYNMFHW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|