C15H20N6O2S — CID 142289495
2-[2-[(1-methylsulfanylpiperidin-4-yl)amino]-7-oxo-8H-pyrido[2,3-d]pyrimidin-6-yl]acetamide (PubChem CID 142289495) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 2-[2-[(1-methylsulfanylpiperidin-4-yl)amino]-7-oxo-8H-pyrido[2,3-d]pyrimidin-6-yl]acetamide.
| Compound Name | 2-[2-[(1-methylsulfanylpiperidin-4-yl)amino]-7-oxo-8H-pyrido[2,3-d]pyrimidin-6-yl]acetamide |
|---|---|
| PubChem CID | 142289495 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[2-[(1-methylsulfanylpiperidin-4-yl)amino]-7-oxo-8H-pyrido[2,3-d]pyrimidin-6-yl]acetamide |
| SMILES | CSN1CCC(Nc2ncc3cc(CC(N)=O)c(=O)[nH]c3n2)CC1 |
| InChI | InChI=1S/C15H20N6O2S/c1-24-21-4-2-11(3-5-21)18-15-17-8-10-6-9(7-12(16)22)14(23)19-13(10)20-15/h6,8,11H,2-5,7H2,1H3,(H2,16,22)(H2,17,18,19,20,23) |
| InChIKey | CYIOWQFBCCXTTR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|