C19H28FN5O2S — CID 142289513
4-fluorocyclohexan-1-ol;2-[(1-methylsulfanylpiperidin-4-yl)amino]-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 142289513) has the molecular formula C19H28FN5O2S and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-fluorocyclohexan-1-ol;2-[(1-methylsulfanylpiperidin-4-yl)amino]-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 4-fluorocyclohexan-1-ol;2-[(1-methylsulfanylpiperidin-4-yl)amino]-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 142289513 |
| Molecular Formula | C19H28FN5O2S |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 4-fluorocyclohexan-1-ol;2-[(1-methylsulfanylpiperidin-4-yl)amino]-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CSN1CCC(Nc2ncc3ccc(=O)[nH]c3n2)CC1.OC1CCC(F)CC1 |
| InChI | InChI=1S/C13H17N5OS.C6H11FO/c1-20-18-6-4-10(5-7-18)15-13-14-8-9-2-3-11(19)16-12(9)17-13;7-5-1-3-6(8)4-2-5/h2-3,8,10H,4-7H2,1H3,(H2,14,15,16,17,19);5-6,8H,1-4H2 |
| InChIKey | YHTIIUGAPJCEPJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|