C20H27N5OS — CID 172601127
2-[7-[(1-methylsulfanylpiperidin-4-yl)amino]-2,6-naphthyridin-1-yl]-2-azaspiro[3.3]heptan-6-ol (PubChem CID 172601127) has the molecular formula C20H27N5OS and a molecular weight of 385.54 g/mol. Its IUPAC name is 2-[7-[(1-methylsulfanylpiperidin-4-yl)amino]-2,6-naphthyridin-1-yl]-2-azaspiro[3.3]heptan-6-ol.
| Compound Name | 2-[7-[(1-methylsulfanylpiperidin-4-yl)amino]-2,6-naphthyridin-1-yl]-2-azaspiro[3.3]heptan-6-ol |
|---|---|
| PubChem CID | 172601127 |
| Molecular Formula | C20H27N5OS |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-[7-[(1-methylsulfanylpiperidin-4-yl)amino]-2,6-naphthyridin-1-yl]-2-azaspiro[3.3]heptan-6-ol |
| SMILES | CSN1CCC(Nc2cc3c(N4CC5(CC(O)C5)C4)nccc3cn2)CC1 |
| InChI | InChI=1S/C20H27N5OS/c1-27-25-6-3-15(4-7-25)23-18-8-17-14(11-22-18)2-5-21-19(17)24-12-20(13-24)9-16(26)10-20/h2,5,8,11,15-16,26H,3-4,6-7,9-10,12-13H2,1H3,(H,22,23) |
| InChIKey | PXNVGJNRDOUPLW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|