C20H27N5O3S — CID 170739922
2-[2-[(1-methylsulfonylpiperidin-4-yl)amino]quinazolin-8-yl]-2-azaspiro[3.3]heptan-6-ol (PubChem CID 170739922) has the molecular formula C20H27N5O3S and a molecular weight of 417.54 g/mol. Its IUPAC name is 2-[2-[(1-methylsulfonylpiperidin-4-yl)amino]quinazolin-8-yl]-2-azaspiro[3.3]heptan-6-ol.
| Compound Name | 2-[2-[(1-methylsulfonylpiperidin-4-yl)amino]quinazolin-8-yl]-2-azaspiro[3.3]heptan-6-ol |
|---|---|
| PubChem CID | 170739922 |
| Molecular Formula | C20H27N5O3S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-[2-[(1-methylsulfonylpiperidin-4-yl)amino]quinazolin-8-yl]-2-azaspiro[3.3]heptan-6-ol |
| SMILES | CS(=O)(=O)N1CCC(Nc2ncc3cccc(N4CC5(CC(O)C5)C4)c3n2)CC1 |
| InChI | InChI=1S/C20H27N5O3S/c1-29(27,28)25-7-5-15(6-8-25)22-19-21-11-14-3-2-4-17(18(14)23-19)24-12-20(13-24)9-16(26)10-20/h2-4,11,15-16,26H,5-10,12-13H2,1H3,(H,21,22,23) |
| InChIKey | UVTXEWBDFPWVRO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |