C13H17N5O2S — CID 175728686
N-(1-methylsulfonylpiperidin-4-yl)pyrido[2,3-d]pyrimidin-2-amine (PubChem CID 175728686) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is N-(1-methylsulfonylpiperidin-4-yl)pyrido[2,3-d]pyrimidin-2-amine.
| Compound Name | N-(1-methylsulfonylpiperidin-4-yl)pyrido[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 175728686 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-(1-methylsulfonylpiperidin-4-yl)pyrido[2,3-d]pyrimidin-2-amine |
| SMILES | CS(=O)(=O)N1CCC(Nc2ncc3cccnc3n2)CC1 |
| InChI | InChI=1S/C13H17N5O2S/c1-21(19,20)18-7-4-11(5-8-18)16-13-15-9-10-3-2-6-14-12(10)17-13/h2-3,6,9,11H,4-5,7-8H2,1H3,(H,14,15,16,17) |
| InChIKey | DGUHBLNKEPEDPY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |