C19H24N4OS — CID 172600610
5-(3,6-dihydro-2H-pyran-4-yl)-N-(1-methylsulfanylpiperidin-4-yl)-2,6-naphthyridin-3-amine (PubChem CID 172600610) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 5-(3,6-dihydro-2H-pyran-4-yl)-N-(1-methylsulfanylpiperidin-4-yl)-2,6-naphthyridin-3-amine.
| Compound Name | 5-(3,6-dihydro-2H-pyran-4-yl)-N-(1-methylsulfanylpiperidin-4-yl)-2,6-naphthyridin-3-amine |
|---|---|
| PubChem CID | 172600610 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 5-(3,6-dihydro-2H-pyran-4-yl)-N-(1-methylsulfanylpiperidin-4-yl)-2,6-naphthyridin-3-amine |
| SMILES | CSN1CCC(Nc2cc3c(C4=CCOCC4)nccc3cn2)CC1 |
| InChI | InChI=1S/C19H24N4OS/c1-25-23-8-3-16(4-9-23)22-18-12-17-15(13-21-18)2-7-20-19(17)14-5-10-24-11-6-14/h2,5,7,12-13,16H,3-4,6,8-11H2,1H3,(H,21,22) |
| InChIKey | TYQZTBBNZASXHG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|