C20H24N6OS — CID 172600222
1-[7-[(1-methylsulfanylpiperidin-4-yl)amino]-2,6-naphthyridine-1-carbonyl]pyrrolidine-3-carbonitrile (PubChem CID 172600222) has the molecular formula C20H24N6OS and a molecular weight of 396.52 g/mol. Its IUPAC name is 1-[7-[(1-methylsulfanylpiperidin-4-yl)amino]-2,6-naphthyridine-1-carbonyl]pyrrolidine-3-carbonitrile.
| Compound Name | 1-[7-[(1-methylsulfanylpiperidin-4-yl)amino]-2,6-naphthyridine-1-carbonyl]pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 172600222 |
| Molecular Formula | C20H24N6OS |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-[7-[(1-methylsulfanylpiperidin-4-yl)amino]-2,6-naphthyridine-1-carbonyl]pyrrolidine-3-carbonitrile |
| SMILES | CSN1CCC(Nc2cc3c(C(=O)N4CCC(C#N)C4)nccc3cn2)CC1 |
| InChI | InChI=1S/C20H24N6OS/c1-28-26-8-4-16(5-9-26)24-18-10-17-15(12-23-18)2-6-22-19(17)20(27)25-7-3-14(11-21)13-25/h2,6,10,12,14,16H,3-5,7-9,13H2,1H3,(H,23,24) |
| InChIKey | NDALBDKHYYMXQO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|