C12H17N3O3 — CID 139925030
4-[(4-methoxy-2-pyridinyl)amino]piperidine-1-carboxylic acid (PubChem CID 139925030) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 4-[(4-methoxy-2-pyridinyl)amino]piperidine-1-carboxylic acid.
| Compound Name | 4-[(4-methoxy-2-pyridinyl)amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 139925030 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4-[(4-methoxy-2-pyridinyl)amino]piperidine-1-carboxylic acid |
| SMILES | COc1ccnc(NC2CCN(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C12H17N3O3/c1-18-10-2-5-13-11(8-10)14-9-3-6-15(7-4-9)12(16)17/h2,5,8-9H,3-4,6-7H2,1H3,(H,13,14)(H,16,17) |
| InChIKey | WGOOGYITTVJFGX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |