C17H25ClN4O3 — CID 156562925
3-[[6-chloro-4-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]amino]piperidine-1-carboxylic acid (PubChem CID 156562925) has the molecular formula C17H25ClN4O3 and a molecular weight of 368.87 g/mol. Its IUPAC name is 3-[[6-chloro-4-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]amino]piperidine-1-carboxylic acid.
| Compound Name | 3-[[6-chloro-4-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 156562925 |
| Molecular Formula | C17H25ClN4O3 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 3-[[6-chloro-4-(1-methylpiperidin-4-yl)oxy-2-pyridinyl]amino]piperidine-1-carboxylic acid |
| SMILES | CN1CCC(Oc2cc(Cl)nc(NC3CCCN(C(=O)O)C3)c2)CC1 |
| InChI | InChI=1S/C17H25ClN4O3/c1-21-7-4-13(5-8-21)25-14-9-15(18)20-16(10-14)19-12-3-2-6-22(11-12)17(23)24/h9-10,12-13H,2-8,11H2,1H3,(H,19,20)(H,23,24) |
| InChIKey | CVVFXGXXQUWIQX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|