C18H20FN3O5S — CID 141132562
4-[[2-(2-fluoro-4-methylsulfonylanilino)-4-pyridinyl]oxy]piperidine-1-carboxylic acid (PubChem CID 141132562) has the molecular formula C18H20FN3O5S and a molecular weight of 409.44 g/mol. Its IUPAC name is 4-[[2-(2-fluoro-4-methylsulfonylanilino)-4-pyridinyl]oxy]piperidine-1-carboxylic acid.
| Compound Name | 4-[[2-(2-fluoro-4-methylsulfonylanilino)-4-pyridinyl]oxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141132562 |
| Molecular Formula | C18H20FN3O5S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 4-[[2-(2-fluoro-4-methylsulfonylanilino)-4-pyridinyl]oxy]piperidine-1-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc(Nc2cc(OC3CCN(C(=O)O)CC3)ccn2)c(F)c1 |
| InChI | InChI=1S/C18H20FN3O5S/c1-28(25,26)14-2-3-16(15(19)11-14)21-17-10-13(4-7-20-17)27-12-5-8-22(9-6-12)18(23)24/h2-4,7,10-12H,5-6,8-9H2,1H3,(H,20,21)(H,23,24) |
| InChIKey | VONIEENDKRLUIT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |