C20H25FN4O5 — CID 66896012
4-[6-[2-fluoro-4-(2-methoxyethoxy)anilino]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylic acid (PubChem CID 66896012) has the molecular formula C20H25FN4O5 and a molecular weight of 420.44 g/mol. Its IUPAC name is 4-[6-[2-fluoro-4-(2-methoxyethoxy)anilino]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylic acid.
| Compound Name | 4-[6-[2-fluoro-4-(2-methoxyethoxy)anilino]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66896012 |
| Molecular Formula | C20H25FN4O5 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-[6-[2-fluoro-4-(2-methoxyethoxy)anilino]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylic acid |
| SMILES | COCCOc1ccc(Nc2ncnc(OC3CCN(C(=O)O)CC3)c2C)c(F)c1 |
| InChI | InChI=1S/C20H25FN4O5/c1-13-18(24-17-4-3-15(11-16(17)21)29-10-9-28-2)22-12-23-19(13)30-14-5-7-25(8-6-14)20(26)27/h3-4,11-12,14H,5-10H2,1-2H3,(H,26,27)(H,22,23,24) |
| InChIKey | NGMCRNJTMDUGAJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|