C21H25FN4O6 — CID 141175577
4-[6-[2-fluoro-4-(2-methoxyethylcarbamoyl)phenoxy]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylic acid (PubChem CID 141175577) has the molecular formula C21H25FN4O6 and a molecular weight of 448.45 g/mol. Its IUPAC name is 4-[6-[2-fluoro-4-(2-methoxyethylcarbamoyl)phenoxy]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylic acid.
| Compound Name | 4-[6-[2-fluoro-4-(2-methoxyethylcarbamoyl)phenoxy]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141175577 |
| Molecular Formula | C21H25FN4O6 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 4-[6-[2-fluoro-4-(2-methoxyethylcarbamoyl)phenoxy]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylic acid |
| SMILES | COCCNC(=O)c1ccc(Oc2ncnc(OC3CCN(C(=O)O)CC3)c2C)c(F)c1 |
| InChI | InChI=1S/C21H25FN4O6/c1-13-19(31-15-5-8-26(9-6-15)21(28)29)24-12-25-20(13)32-17-4-3-14(11-16(17)22)18(27)23-7-10-30-2/h3-4,11-12,15H,5-10H2,1-2H3,(H,23,27)(H,28,29) |
| InChIKey | GEESTTGNULVBLK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|