C22H22N4O7S — CID 123193793
4-[6-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylic acid (PubChem CID 123193793) has the molecular formula C22H22N4O7S and a molecular weight of 486.51 g/mol. Its IUPAC name is 4-[6-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylic acid.
| Compound Name | 4-[6-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 123193793 |
| Molecular Formula | C22H22N4O7S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 4-[6-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-2-methoxyphenoxy]-5-methylpyrimidin-4-yl]oxypiperidine-1-carboxylic acid |
| SMILES | COc1cc(C=C2SC(=O)NC2=O)ccc1Oc1ncnc(OC2CCN(C(=O)O)CC2)c1C |
| InChI | InChI=1S/C22H22N4O7S/c1-12-19(32-14-5-7-26(8-6-14)22(29)30)23-11-24-20(12)33-15-4-3-13(9-16(15)31-2)10-17-18(27)25-21(28)34-17/h3-4,9-11,14H,5-8H2,1-2H3,(H,29,30)(H,25,27,28) |
| InChIKey | VFWCBKJUNSODBE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 140.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|